Products 100201-57-8

CAS 100201-57-8 appears in our catalog under these names: 2,3-Dihydroxy-3-(4-hydroxyphenyl)propanoic acid, 3-Hydroxy-3-(4-hydroxyphenyl)-lactic acid 95%, 3-Hydroxy-3-(4-hydroxyphenyl)-lactic acid. Offered by: Biosynth, Ambeed, MedChemExpress. Available pack sizes: 50mg, 0,5g, 5mg, 10mg, 25mg, 100mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

2,3-dihydroxy-3-(4-hydroxyphenyl)propanoic acid (CAS 100201-57-8) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2,3-dihydroxy-3-(4-hydroxyphenyl)propanoic acid. InChIKey: LERAXVLCHXAZGX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O5
Molecular weight198.17 g/mol
IUPAC name2,3-dihydroxy-3-(4-hydroxyphenyl)propanoic acid
InChIKeyLERAXVLCHXAZGX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(C(C(=O)O)O)O)O

Computed by PubChem (NCBI)