CAS 1002032-97-4 is the registry number for 1-(2,3,4,6-Tetrafluorobenzyl)-1h-pyrazol-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-amine (CAS 1002032-97-4) is a chemical compound with the molecular formula C10H7F4N3 and a molecular weight of 245.18 g/mol. IUPAC name: 1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-amine. InChIKey: QYCFREDMJJEAKC-UHFFFAOYSA-N.
| Molecular formula | C10H7F4N3 |
|---|---|
| Molecular weight | 245.18 g/mol |
| IUPAC name | 1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-amine |
| InChIKey | QYCFREDMJJEAKC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)CN2C=C(C=N2)N)F |
Computed by PubChem (NCBI)