Products 1040724-42-2
CAS 1040724-42-2 is the registry number for 5-(4-Fluoro-3-(trifluoromethyl)phenyl)-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazol-3-amine (CAS 1040724-42-2) is a chemical compound with the molecular formula C10H7F4N3 and a molecular weight of 245.18 g/mol. IUPAC name: 5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazol-3-amine. InChIKey: DOVHDNOKUISQLJ-UHFFFAOYSA-N.
| Molecular formula | C10H7F4N3 |
|---|---|
| Molecular weight | 245.18 g/mol |
| IUPAC name | 5-[4-fluoro-3-(trifluoromethyl)phenyl]-1H-pyrazol-3-amine |
| InChIKey | DOVHDNOKUISQLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NN2)N)C(F)(F)F)F |
Computed by PubChem (NCBI)