CAS 895929-09-6 is the registry number for 1-((2,3,5,6-Tetrafluorophenyl)methyl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-amine (CAS 895929-09-6) is a chemical compound with the molecular formula C10H7F4N3 and a molecular weight of 245.18 g/mol. IUPAC name: 1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-amine. InChIKey: FIKZUMYTIFYXAB-UHFFFAOYSA-N.
| Molecular formula | C10H7F4N3 |
|---|---|
| Molecular weight | 245.18 g/mol |
| IUPAC name | 1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-amine |
| InChIKey | FIKZUMYTIFYXAB-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1N)CC2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)