CAS 1188909-71-8 appears in our catalog under these names: 1-(4-Fluorophenyl)-3-(trifluoromethyl)-1h-pyrazol-5-amine, 95%, 1-(4-Fluorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine, 97%, 1-(4-Fluorophenyl)-3-(trifluoromethyl)-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-5-amine (CAS 1188909-71-8) is a chemical compound with the molecular formula C10H7F4N3 and a molecular weight of 245.18 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-5-amine. InChIKey: WBTLTMKEBLEGOU-UHFFFAOYSA-N.
| Molecular formula | C10H7F4N3 |
|---|---|
| Molecular weight | 245.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-(trifluoromethyl)pyrazol-5-amine |
| InChIKey | WBTLTMKEBLEGOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=CC(=N2)C(F)(F)F)N)F |
Computed by PubChem (NCBI)