CAS 1002557-04-1 appears in our catalog under these names: 2-(4-Chlorophenyl)-2-methylpropylamine hydrochloride, 95%, 2–(4–Chlorophenyl)–2–methylpropylamine Hydrochloride, 2-(4-Chlorophenyl)-2-methylpropylamine HCl, ≥95%, ≥95%, 2-(4-Chlorophenyl)-2-methylpropylamine HCl, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg.
2-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 1002557-04-1) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: SAMRMCHVQOVZQK-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | SAMRMCHVQOVZQK-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)