CAS 1015136-53-4 is the registry number for 2-(Chloromethyl)-4-ethyl-3,5-dimethylpyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(chloromethyl)-4-ethyl-3,5-dimethylpyridine;hydrochloride (CAS 1015136-53-4) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 2-(chloromethyl)-4-ethyl-3,5-dimethylpyridine;hydrochloride. InChIKey: UXDAULTXBBUCLP-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-(chloromethyl)-4-ethyl-3,5-dimethylpyridine;hydrochloride |
| InChIKey | UXDAULTXBBUCLP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC=C1C)CCl)C.Cl |
Computed by PubChem (NCBI)