CAS 72954-91-7 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride, 95%, 1–(4–Chlorophenyl)–2–methylpropan–1–amine hydrochloride, 1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride, 1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride, 96%, 96%, 1-(4-Chlorophenyl)-2-methylpropan-1-amine hydrochloride, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 72954-91-7) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: VCBGQWZZQKYLLK-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | VCBGQWZZQKYLLK-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)