CAS 23510-24-9 appears in our catalog under these names: N-(4-Chlorobenzyl)-2-propanamine hydrochloride, 95%, N-(4-Chlorobenzyl)-2-propanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-[(4-chlorophenyl)methyl]propan-2-amine;hydrochloride (CAS 23510-24-9) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: N-[(4-chlorophenyl)methyl]propan-2-amine;hydrochloride. InChIKey: VTCKCXRUVZNKEF-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | N-[(4-chlorophenyl)methyl]propan-2-amine;hydrochloride |
| InChIKey | VTCKCXRUVZNKEF-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)