CAS 1002970-32-2 appears in our catalog under these names: 3-Chloro-4-[(3-chlorophenyl)methoxy]benzoic acid, 95%, 3-Chloro-4-((3-chlorophenyl)methoxy)benzoic acid, 3-Chloro-4-[(3-chlorophenyl)methox y]benzoic acid, 95%, 95%, 3-Chloro-4-((3-chlorobenzyl)oxy)benzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-chloro-4-[(3-chlorophenyl)methoxy]benzoic acid (CAS 1002970-32-2) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 3-chloro-4-[(3-chlorophenyl)methoxy]benzoic acid. InChIKey: YZOMEFGASCKZMH-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 3-chloro-4-[(3-chlorophenyl)methoxy]benzoic acid |
| InChIKey | YZOMEFGASCKZMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)COC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)