Products 861065-47-6
CAS 861065-47-6 appears in our catalog under these names: 2-(2,5-Dichlorophenoxy)-2-phenylacetic acid, 95%, 2-(2,5-Dichlorophenoxy)-2-phenylacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(2,5-dichlorophenoxy)-2-phenylacetic acid (CAS 861065-47-6) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 2-(2,5-dichlorophenoxy)-2-phenylacetic acid. InChIKey: KPQSCXHTLWZXOP-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 2-(2,5-dichlorophenoxy)-2-phenylacetic acid |
| InChIKey | KPQSCXHTLWZXOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)