CAS 3152-12-3 appears in our catalog under these names: 2,2'-Dichlorobenzilic acid, 95%, 2,2-Bis(2-chlorophenyl)-2-hydroxyacetic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg.
2,2-bis(2-chlorophenyl)-2-hydroxyacetic acid (CAS 3152-12-3) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 2,2-bis(2-chlorophenyl)-2-hydroxyacetic acid. InChIKey: OJYHUFNZIWRMPT-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 2,2-bis(2-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | OJYHUFNZIWRMPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=CC=C2Cl)(C(=O)O)O)Cl |
Computed by PubChem (NCBI)