Products 56442-18-3
CAS 56442-18-3 appears in our catalog under these names: 4-[(3,4-Dichlorobenzyl)oxy]benzenecarboxylic acid, 95%, 4-((3,4-Dichlorobenzyl)oxy)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-[(3,4-dichlorophenyl)methoxy]benzoic acid (CAS 56442-18-3) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)methoxy]benzoic acid. InChIKey: ZCGYVYRMBOFTPZ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 4-[(3,4-dichlorophenyl)methoxy]benzoic acid |
| InChIKey | ZCGYVYRMBOFTPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-[(3,4-dichlorobenzyl)oxy]benzoic acid, 4-[(3,4-dichlorophenyl)methoxy]benzoic Acid, 4-((3,4-Dichlorobenzyl)oxy)benzoic acid, 4-((3,4-Dichlorophenyl)methoxy)benzoic acid, 4-[(3,4-Dichlorobenzyl)oxy]benzenecarboxylic acid, ZCGYVYRMBOFTPZ-UHFFFAOYSA-N, 4-((3,4-Dichlorobenzyl)oxy)benzoicacid