CAS 1003043-34-2 appears in our catalog under these names: 2–Bromo–3–methylpyridine–5–boronic acid, 2-Bromo-3-methylpyridine-5-boronic acid, 97% , (6-Bromo-5-methylpyridin-3-yl)boronic acid, 95%, 95%, 6-Bromo-5-methylpyridine-3-boronic acid, 95%, (6-Bromo-5-methylpyridin-3-yl)boronic acid, 95%. Offered by: GLPBio, Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100g, 500g, 10g, 25g.
(6-bromo-5-methyl-3-pyridinyl)boronic acid (CAS 1003043-34-2) is a chemical compound with the molecular formula C6H7BBrNO2 and a molecular weight of 215.84 g/mol. IUPAC name: (6-bromo-5-methyl-3-pyridinyl)boronic acid. InChIKey: IPCXBKSYMWZLBR-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO2 |
|---|---|
| Molecular weight | 215.84 g/mol |
| IUPAC name | (6-bromo-5-methyl-3-pyridinyl)boronic acid |
| InChIKey | IPCXBKSYMWZLBR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Br)C)(O)O |
Computed by PubChem (NCBI)