CAS 2225179-12-2 is the registry number for 3–Amino–5–bromophenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-amino-5-bromophenyl)boronic acid (CAS 2225179-12-2) is a chemical compound with the molecular formula C6H7BBrNO2 and a molecular weight of 215.84 g/mol. IUPAC name: (3-amino-5-bromophenyl)boronic acid. InChIKey: CQDKIIWHUZNFRW-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO2 |
|---|---|
| Molecular weight | 215.84 g/mol |
| IUPAC name | (3-amino-5-bromophenyl)boronic acid |
| InChIKey | CQDKIIWHUZNFRW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)N)(O)O |
Computed by PubChem (NCBI)