CAS 1003043-37-5 appears in our catalog under these names: 2-Chloro-6-isopropylpyridine-3-boronic acid, 97%, (2-Chloro-6-isopropylpyridin-3-yl)boronic acid, 97%, (2-Chloro-6-isopropylpyridin-3-yl)boronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
(2-chloro-6-propan-2-yl-3-pyridinyl)boronic acid (CAS 1003043-37-5) is a chemical compound with the molecular formula C8H11BClNO2 and a molecular weight of 199.44 g/mol. IUPAC name: (2-chloro-6-propan-2-yl-3-pyridinyl)boronic acid. InChIKey: FBLHWIQSYHMHSK-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO2 |
|---|---|
| Molecular weight | 199.44 g/mol |
| IUPAC name | (2-chloro-6-propan-2-yl-3-pyridinyl)boronic acid |
| InChIKey | FBLHWIQSYHMHSK-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(C)C)Cl)(O)O |
Computed by PubChem (NCBI)