Products 2225170-88-5
CAS 2225170-88-5 is the registry number for 5–Chloro–2–(iso–propyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(5-chloro-2-propan-2-yl-3-pyridinyl)boronic acid (CAS 2225170-88-5) is a chemical compound with the molecular formula C8H11BClNO2 and a molecular weight of 199.44 g/mol. IUPAC name: (5-chloro-2-propan-2-yl-3-pyridinyl)boronic acid. InChIKey: JNYSMIZUBBSAIK-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO2 |
|---|---|
| Molecular weight | 199.44 g/mol |
| IUPAC name | (5-chloro-2-propan-2-yl-3-pyridinyl)boronic acid |
| InChIKey | JNYSMIZUBBSAIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1C(C)C)Cl)(O)O |
Computed by PubChem (NCBI)