CAS 1437054-10-8 is the registry number for 6-(Aminomethyl)benzo[c][1,2]oxaborol-1(3H)-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine;hydrochloride (CAS 1437054-10-8) is a chemical compound with the molecular formula C8H11BClNO2 and a molecular weight of 199.44 g/mol. IUPAC name: (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine;hydrochloride. InChIKey: MVBRGWGYWKLQKX-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO2 |
|---|---|
| Molecular weight | 199.44 g/mol |
| IUPAC name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine;hydrochloride |
| InChIKey | MVBRGWGYWKLQKX-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)CN)O.Cl |
Computed by PubChem (NCBI)