Products 175883-64-4

CAS 175883-64-4 is the registry number for 3-Chloro-4-(n,n-dimethylamino)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[3-chloro-4-(dimethylamino)phenyl]boronic acid (CAS 175883-64-4) is a chemical compound with the molecular formula C8H11BClNO2 and a molecular weight of 199.44 g/mol. IUPAC name: [3-chloro-4-(dimethylamino)phenyl]boronic acid. InChIKey: IAPBYBNIGHCVIS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11BClNO2
Molecular weight199.44 g/mol
IUPAC name[3-chloro-4-(dimethylamino)phenyl]boronic acid
InChIKeyIAPBYBNIGHCVIS-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)N(C)C)Cl)(O)O

Computed by PubChem (NCBI)