Products 1003323-26-9
CAS 1003323-26-9 is the registry number for 3,5-Bis(methoxymethyl)phenylboronicAcidPinacolEster, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-[3,5-bis(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1003323-26-9) is a chemical compound with the molecular formula C16H25BO4 and a molecular weight of 292.2 g/mol. IUPAC name: 2-[3,5-bis(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JSRAVTWWXNWEPV-UHFFFAOYSA-N.
| Molecular formula | C16H25BO4 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-[3,5-bis(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JSRAVTWWXNWEPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)COC)COC |
Computed by PubChem (NCBI)