CAS 2096329-95-0 appears in our catalog under these names: 3-Isopropoxy-5-methoxyphenylboronic acid, pinacol ester, 96%, 3-Isopropoxy-5-methoxyphenylboronic acid, pinacol ester 96%, 3-Isopropoxy-5-methoxyphenylboronic acid, pinacol ester, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(3-methoxy-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096329-95-0) is a chemical compound with the molecular formula C16H25BO4 and a molecular weight of 292.2 g/mol. IUPAC name: 2-(3-methoxy-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DFTUUNAEKXIMST-UHFFFAOYSA-N.
| Molecular formula | C16H25BO4 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-(3-methoxy-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DFTUUNAEKXIMST-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(C)C)OC |
Computed by PubChem (NCBI)