Products 2828439-51-4
CAS 2828439-51-4 is the registry number for 2-(3-Methoxy-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(3-methoxy-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2828439-51-4) is a chemical compound with the molecular formula C16H25BO4 and a molecular weight of 292.2 g/mol. IUPAC name: 2-(3-methoxy-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WPBZHGYNKHDUSS-UHFFFAOYSA-N.
| Molecular formula | C16H25BO4 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-(3-methoxy-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WPBZHGYNKHDUSS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCC)OC |
Computed by PubChem (NCBI)