CAS 2096469-97-3 is the registry number for 2-(3,5-Dimethoxy-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethoxy-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096469-97-3) is a chemical compound with the molecular formula C16H25BO4 and a molecular weight of 292.2 g/mol. IUPAC name: 2-(3,5-dimethoxy-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WMWFWXUWVQFWMC-UHFFFAOYSA-N.
| Molecular formula | C16H25BO4 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-(3,5-dimethoxy-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WMWFWXUWVQFWMC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC(=C2C)OC)OC)C |
Computed by PubChem (NCBI)