CAS 1003709-67-8 appears in our catalog under these names: 4-Methoxy-2,3,5-trifluorobenzoic acid, 4-Methoxy-2,3,5-trifluorobenzoic acid 95%, 4-Methoxy-2,3,5-trifluorobenzoic acid, 97%, 97%, 4-Methoxy-2,3,5-trifluorobenzoic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2g, 5g, 10g, 25g, 250mg, 1g, 100mg.
2,3,5-trifluoro-4-methoxybenzoic acid (CAS 1003709-67-8) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,3,5-trifluoro-4-methoxybenzoic acid. InChIKey: SGQBBRRGMRJQPE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-methoxybenzoic acid |
| InChIKey | SGQBBRRGMRJQPE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)