CAS 1003932-30-6 appears in our catalog under these names: 3,4-Diethyl 2-chloropyridine-3,4-dicarboxylate, 95%, 3,4-Diethyl 2-chloropyridine-3,4-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Diethyl 2-chloropyridine-3,4-dicarboxylate (CAS 1003932-30-6) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: diethyl 2-chloropyridine-3,4-dicarboxylate. InChIKey: VMMVYANEBFPIHV-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | diethyl 2-chloropyridine-3,4-dicarboxylate |
| InChIKey | VMMVYANEBFPIHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)Cl)C(=O)OCC |
Computed by PubChem (NCBI)