Products 1003944-32-8
CAS 1003944-32-8 appears in our catalog under these names: 7-Fluoro-2-methoxy-1,5-naphthyridine, 95%, 7–Fluoro–2–methoxy–1，5–naphthyridine, 7-Fluoro-2-methoxy-1,5-naphthyridine 95%, 7-Fluoro-2-methoxy-1,5-naphthyridine, 95%, 95%, 7-Fluoro-2-methoxy-1,5-naphthyridine, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg.
7-fluoro-2-methoxy-1,5-naphthyridine (CAS 1003944-32-8) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 7-fluoro-2-methoxy-1,5-naphthyridine. InChIKey: JRNKDUBTSNDYCD-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 7-fluoro-2-methoxy-1,5-naphthyridine |
| InChIKey | JRNKDUBTSNDYCD-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=CC(=C2)F |
Computed by PubChem (NCBI)