Products 343771-07-3
CAS 343771-07-3 is the registry number for 5-(3-Fluorophenyl)-3-methyl-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
5-(3-fluorophenyl)-3-methyl-1,2,4-oxadiazole (CAS 343771-07-3) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 5-(3-fluorophenyl)-3-methyl-1,2,4-oxadiazole. InChIKey: LXBQVGOCMHOZCF-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-3-methyl-1,2,4-oxadiazole |
| InChIKey | LXBQVGOCMHOZCF-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)