CAS 1250981-00-0 appears in our catalog under these names: 4-(3-Fluorophenyl)-1,2-oxazol-5-amine, 95%, 4-(3-Fluorophenyl)-1,2-oxazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g, 50mg.
4-(3-fluorophenyl)-1,2-oxazol-5-amine (CAS 1250981-00-0) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 4-(3-fluorophenyl)-1,2-oxazol-5-amine. InChIKey: WSEKPMMEQGXONX-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | WSEKPMMEQGXONX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=C(ON=C2)N |
Computed by PubChem (NCBI)