CAS 1248955-29-4 appears in our catalog under these names: 4-(2-Fluorophenyl)-1,2-oxazol-5-amine, 4-(2-Fluorophenyl)-1,2-oxazol-5-amine, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 1g, 250mg, 10g.
4-(2-fluorophenyl)-1,2-oxazol-5-amine (CAS 1248955-29-4) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,2-oxazol-5-amine. InChIKey: DTKRBINQDFJFMP-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | DTKRBINQDFJFMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(ON=C2)N)F |
Computed by PubChem (NCBI)