CAS 1004192-94-2 appears in our catalog under these names: 2-(4-Chloro-1H-pyrazol-1-yl)-2-methylpropanoic acid, 2-(4-Chloro-1H-pyrazol-1-yl)-2-methylpropanoic acid, 98+%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-(4-chloropyrazol-1-yl)-2-methylpropanoic acid (CAS 1004192-94-2) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 2-(4-chloropyrazol-1-yl)-2-methylpropanoic acid. InChIKey: FXOYRQOITFKUMP-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 2-(4-chloropyrazol-1-yl)-2-methylpropanoic acid |
| InChIKey | FXOYRQOITFKUMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=C(C=N1)Cl |
Computed by PubChem (NCBI)