Products 1004194-55-1

CAS 1004194-55-1 is the registry number for 2-((5-Methyl-3-nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 1004194-55-1) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: 2-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: BIOOMQZEIOGAFN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O4
Molecular weight261.23 g/mol
IUPAC name2-[(5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid
InChIKeyBIOOMQZEIOGAFN-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CC2=CC=CC=C2C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)