CAS 1004284-08-5 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)butan-2-amine, 95%, 1-(2,4-Dichlorophenyl)butan-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
1-(2,4-dichlorophenyl)butan-2-amine (CAS 1004284-08-5) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)butan-2-amine. InChIKey: MXSWGTIGKBARQA-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)butan-2-amine |
| InChIKey | MXSWGTIGKBARQA-UHFFFAOYSA-N |
| SMILES | CCC(CC1=C(C=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)