CAS 100445-95-2 appears in our catalog under these names: N-(3-Hydroxy-2,6-dimethylphenyl)acetamide, 97%, 3-Acetamido-2,4-dimethylphenol, N-(3-Hydroxy-2,6-dimethylphenyl)acetamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 50mg, 0,5g.
N-(3-hydroxy-2,6-dimethylphenyl)acetamide (CAS 100445-95-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: N-(3-hydroxy-2,6-dimethylphenyl)acetamide. InChIKey: TVLUGNBVBWVYLD-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | N-(3-hydroxy-2,6-dimethylphenyl)acetamide |
| InChIKey | TVLUGNBVBWVYLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)NC(=O)C |
Computed by PubChem (NCBI)