CAS 1004451-69-7 is the registry number for 3-(1,3-Dioxaindan-5-yl)-1-phenyl-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(1,3-benzodioxol-5-yl)-1-phenylpyrazole-4-carbaldehyde (CAS 1004451-69-7) is a chemical compound with the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: IVFWJLCVAHTFCT-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O3 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | IVFWJLCVAHTFCT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NN(C=C3C=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)