CAS 739-54-8 is the registry number for N-(1,2,3,4-Tetrahydro-2-oxo-3-quinolyl)-phthalimide. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg.
2-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)isoindole-1,3-dione (CAS 739-54-8) is a chemical compound with the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. IUPAC name: 2-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)isoindole-1,3-dione. InChIKey: VYKPQMCKSTUILS-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O3 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 2-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)isoindole-1,3-dione |
| InChIKey | VYKPQMCKSTUILS-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=CC=CC=C21)N3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)