Products 1172330-09-4

CAS 1172330-09-4 is the registry number for 3-(2-Phenoxypyrimidin-5-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(2-phenoxypyrimidin-5-yl)benzoic acid (CAS 1172330-09-4) is a chemical compound with the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. IUPAC name: 3-(2-phenoxypyrimidin-5-yl)benzoic acid. InChIKey: PJYRKPKKJRAYAM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12N2O3
Molecular weight292.29 g/mol
IUPAC name3-(2-phenoxypyrimidin-5-yl)benzoic acid
InChIKeyPJYRKPKKJRAYAM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=NC=C(C=N2)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)