CAS 297743-16-9 is the registry number for 2,3-Di-2-furanyl-6-methoxyquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,3-bis(furan-2-yl)-6-methoxyquinoxaline (CAS 297743-16-9) is a chemical compound with the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. IUPAC name: 2,3-bis(furan-2-yl)-6-methoxyquinoxaline. InChIKey: KERKANPWIRULOP-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O3 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 2,3-bis(furan-2-yl)-6-methoxyquinoxaline |
| InChIKey | KERKANPWIRULOP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C(=N2)C3=CC=CO3)C4=CC=CO4 |
Computed by PubChem (NCBI)