Products 297743-16-9

CAS 297743-16-9 is the registry number for 2,3-Di-2-furanyl-6-methoxyquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2,3-bis(furan-2-yl)-6-methoxyquinoxaline (CAS 297743-16-9) is a chemical compound with the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. IUPAC name: 2,3-bis(furan-2-yl)-6-methoxyquinoxaline. InChIKey: KERKANPWIRULOP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12N2O3
Molecular weight292.29 g/mol
IUPAC name2,3-bis(furan-2-yl)-6-methoxyquinoxaline
InChIKeyKERKANPWIRULOP-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)N=C(C(=N2)C3=CC=CO3)C4=CC=CO4

Computed by PubChem (NCBI)