CAS 1004775-33-0 appears in our catalog under these names: 3-Methoxy-4-(trifluoromethyl)phenylboronic Acid, (3–Methoxy–4–(trifluoromethyl)phenyl)boronic acid, (3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid 97%, (3-Methoxy-4-(trifluoromethyl)phenyl)boronicacid, 98%, 98%, (3-Methoxy-4-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 100mg.
[3-methoxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1004775-33-0) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [3-methoxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: UHOZSZGYFBEVBA-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [3-methoxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | UHOZSZGYFBEVBA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)OC)(O)O |
Computed by PubChem (NCBI)