CAS 100478-05-5 is the registry number for 7-CHLORO-5-(TRIFLUOROMETHYL)-1H-PYRAZOLO[4,3-B]PYRIDINE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-5-(trifluoromethyl)-1H-pyrazolo[4,5-b]pyridine (CAS 100478-05-5) is a chemical compound with the molecular formula C7H3ClF3N3 and a molecular weight of 221.57 g/mol. IUPAC name: 7-chloro-5-(trifluoromethyl)-1H-pyrazolo[4,5-b]pyridine. InChIKey: ZMRWVWXQRKPAEV-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3 |
|---|---|
| Molecular weight | 221.57 g/mol |
| IUPAC name | 7-chloro-5-(trifluoromethyl)-1H-pyrazolo[4,5-b]pyridine |
| InChIKey | ZMRWVWXQRKPAEV-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C=NN2)N=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)