Products 1218993-18-0
CAS 1218993-18-0 appears in our catalog under these names: 3-Carbamoyl-1-methyl-d3-pyridinium Chloride, >95% (HPLC), 3-Carbamoyl-1-methyl-d3-pyridinium Chloride, 99 atom % D, min 98% Chemical Purity, TRIA–662–d3, TRIA-662-d3, 99.44%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 0,25g, 0,1g, 10 mg, 25 mg, 5 mg.
1-(trideuteriomethyl)pyridin-1-ium-3-carboxamide chloride (CAS 1218993-18-0) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 175.63 g/mol. IUPAC name: 1-(trideuteriomethyl)pyridin-1-ium-3-carboxamide chloride. InChIKey: BWVDQVQUNNBTLK-NIIDSAIPSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | 1-(trideuteriomethyl)pyridin-1-ium-3-carboxamide chloride |
| InChIKey | BWVDQVQUNNBTLK-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])[N+]1=CC=CC(=C1)C(=O)N.[Cl-] |
Computed by PubChem (NCBI)