CAS 100510-66-5 appears in our catalog under these names: 6'-Aminospiro[cyclopentane-1,3'-indolin]-2'-one, 95%, 6'–Aminospiro(cyclopentane–1,3'–indolin)–2'–one, 6′-Aminospiro[cyclopentane-1,3′-[3H]indol]-2′(1′H)-one, 96%, 96%, 6'-Aminospiro[cyclopentane-1,3'-indolin]-2'-one, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg.
6-aminospiro[1H-indole-3,1'-cyclopentane]-2-one (CAS 100510-66-5) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 6-aminospiro[1H-indole-3,1'-cyclopentane]-2-one. InChIKey: IHGQTAJGOPOWQT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 6-aminospiro[1H-indole-3,1'-cyclopentane]-2-one |
| InChIKey | IHGQTAJGOPOWQT-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C3=C(C=C(C=C3)N)NC2=O |
Computed by PubChem (NCBI)