Products 1005174-24-2
CAS 1005174-24-2 is the registry number for (E)-3-(2-Isopropyl-6-(trifluoromethyl)pyridin-3-yl)acrylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (CAS 1005174-24-2) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: (E)-3-[2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid. InChIKey: QMVFBSPQPFMMFL-GQCTYLIASA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | (E)-3-[2-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| InChIKey | QMVFBSPQPFMMFL-GQCTYLIASA-N |
| SMILES | CC(C)C1=C(C=CC(=N1)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)