Products 1005336-17-3
CAS 1005336-17-3 is the registry number for (2E)-3-(Dimethylamino)-1-(2-hydroxy-4-methoxyphenyl)-2-propen-1-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(E)-3-(dimethylamino)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one (CAS 1005336-17-3) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one. InChIKey: GIWPLJABJPALKR-VOTSOKGWSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(2-hydroxy-4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | GIWPLJABJPALKR-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=C(C=C1)OC)O |
Computed by PubChem (NCBI)