CAS 1005412-03-2 is the registry number for Fmoc-beta-Ala(SO3H)-OH. Offered by: Creative Peptides, Iris Biotech. Available pack sizes: 1g, 5g, 25g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid (CAS 1005412-03-2) is a chemical compound with the molecular formula C18H17NO7S and a molecular weight of 391.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid. InChIKey: BUIGLPNXWMXPGK-UHFFFAOYSA-N.
| Molecular formula | C18H17NO7S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid |
| InChIKey | BUIGLPNXWMXPGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(C(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)