Products 1005412-03-2

CAS 1005412-03-2 is the registry number for Fmoc-beta-Ala(SO3H)-OH. Offered by: Creative Peptides, Iris Biotech. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid (CAS 1005412-03-2) is a chemical compound with the molecular formula C18H17NO7S and a molecular weight of 391.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid. InChIKey: BUIGLPNXWMXPGK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO7S
Molecular weight391.4 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-sulfopropanoic acid
InChIKeyBUIGLPNXWMXPGK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(C(=O)O)S(=O)(=O)O

Computed by PubChem (NCBI)