CAS 751470-47-0 appears in our catalog under these names: Fmoc-L-cysteic Acid, >95% (HPLC), (R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–sulfopropanoic acid, Fmoc-L-cysteic acid, Fmoc-Cysteic acid 97%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-sulfo-L-alanine, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 500mg, 100g, 10g, 25g, 5g, 2g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid (CAS 751470-47-0) is a chemical compound with the molecular formula C18H17NO7S and a molecular weight of 391.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid. InChIKey: BUTKUPGRCQCTTA-INIZCTEOSA-N.
| Molecular formula | C18H17NO7S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid |
| InChIKey | BUTKUPGRCQCTTA-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)