CAS 749820-65-3 appears in our catalog under these names: Fmoc-D-Ala(sulfo)-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-sulfopropanoic acid, 95%, 95%, (((9H-Fluoren-9-yl)methoxy)carbonyl)(sulfo)-L-alanine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid (CAS 749820-65-3) is a chemical compound with the molecular formula C18H17NO7S and a molecular weight of 391.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid. InChIKey: BUTKUPGRCQCTTA-MRXNPFEDSA-N.
| Molecular formula | C18H17NO7S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfopropanoic acid |
| InChIKey | BUTKUPGRCQCTTA-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)