CAS 1005584-30-4 is the registry number for 2-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)propanohydrazide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanehydrazide (CAS 1005584-30-4) is a chemical compound with the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanehydrazide. InChIKey: JLIBFSITCDGEAL-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4O |
|---|---|
| Molecular weight | 216.67 g/mol |
| IUPAC name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)propanehydrazide |
| InChIKey | JLIBFSITCDGEAL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C(=O)NN)C)Cl |
Computed by PubChem (NCBI)