CAS 1006336-93-1 is the registry number for 3-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)-N'-hydroxypropanimidamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxypropanimidamide (CAS 1006336-93-1) is a chemical compound with the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. IUPAC name: 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxypropanimidamide. InChIKey: AVDDNKJONNYUNZ-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4O |
|---|---|
| Molecular weight | 216.67 g/mol |
| IUPAC name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxypropanimidamide |
| InChIKey | AVDDNKJONNYUNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC/C(=N/O)/N)C)Cl |
Computed by PubChem (NCBI)