CAS 2137578-59-5 is the registry number for 6-(3-Aminopyrrolidin-1-yl)-3,4-dihydropyrimidin-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-aminopyrrolidin-1-yl)-1H-pyrimidin-6-one;hydrochloride (CAS 2137578-59-5) is a chemical compound with the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. IUPAC name: 4-(3-aminopyrrolidin-1-yl)-1H-pyrimidin-6-one;hydrochloride. InChIKey: YJZFFKVGYKVCKB-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4O |
|---|---|
| Molecular weight | 216.67 g/mol |
| IUPAC name | 4-(3-aminopyrrolidin-1-yl)-1H-pyrimidin-6-one;hydrochloride |
| InChIKey | YJZFFKVGYKVCKB-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C2=CC(=O)NC=N2.Cl |
Computed by PubChem (NCBI)