Products 1354000-08-0
CAS 1354000-08-0 is the registry number for (S)-6-(Pyrrolidin-3-yloxy)pyrimidin-4-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-[(3S)-pyrrolidin-3-yl]oxypyrimidin-4-amine;hydrochloride (CAS 1354000-08-0) is a chemical compound with the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. IUPAC name: 6-[(3S)-pyrrolidin-3-yl]oxypyrimidin-4-amine;hydrochloride. InChIKey: QKTXNEVBNRLJCH-RGMNGODLSA-N.
| Molecular formula | C8H13ClN4O |
|---|---|
| Molecular weight | 216.67 g/mol |
| IUPAC name | 6-[(3S)-pyrrolidin-3-yl]oxypyrimidin-4-amine;hydrochloride |
| InChIKey | QKTXNEVBNRLJCH-RGMNGODLSA-N |
| SMILES | C1CNC[C@H]1OC2=NC=NC(=C2)N.Cl |
Computed by PubChem (NCBI)